| Product Name | Glycine n-hexyl ester hydrochloride |
| CAS No. | 75980-28-8 |
| Synonyms | H-Gly-OHex.HCl; hexyl glycinate hydrochloride; hexyl glycinate |
| InChI | InChI=1/C8H17NO2/c1-2-3-4-5-6-11-8(10)7-9/h2-7,9H2,1H3 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.2261 |
| Density | 0.949g/cm3 |
| Boiling point | 203.3°C at 760 mmHg |
| Flash point | 73.5°C |
| Refractive index | 1.442 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
75980-28-8 glycine n-hexyl ester hydrochloride
service@apichina.com