| Product Name | Glyceryl monoricinoleate |
| CAS No. | 1323-38-2 |
| Synonyms | 9-Octadecenoic acid, 12-hydroxy-, monoester with 1,2,3-propanetriol, (R-(Z))-; AI3-00967; UNII-ZUE0CEL42O; (R)-12-Hydroxyoleic acid, monoester with glycerol; 9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, monoester with 1,2,3-propanetriol; 9-Octadecenoic acid, 12-hydroxy-, (R-(Z))-, monoester with 1,2,3-propanetriol; 9-Octadecenoic acid, 12-hydroxy-, (theta-(Z))-, monoester with 1,2,3-propanetriol; 2,3-dihydroxypropyl 12-hydroxyoctadec-9-enoate; 2,3-dihydroxypropyl (9Z,12R)-12-hydroxyoctadec-9-enoate; 2,3-dihydroxypropyl (Z)-12-hydroxyoctadec-9-enoate |
| InChI | InChI=1/C21H40O5/c1-2-3-4-11-14-19(23)15-12-9-7-5-6-8-10-13-16-21(25)26-18-20(24)17-22/h9,12,19-20,22-24H,2-8,10-11,13-18H2,1H3/b12-9-/t19-,20-/m1/s1 |
| Molecular Formula | C21H40O5 |
| Molecular Weight | 372.5393 |
| Density | 1.019g/cm3 |
| Boiling point | 520.5°C at 760 mmHg |
| Flash point | 169.8°C |
| Refractive index | 1.49 |
1323-38-2 glyceryl monoricinoleate
service@apichina.com