Product Name | Glycerides, C16-18 and C18-unsatd. |
CAS No. | 67701-30-8 |
Synonyms | (C16-C18) and (C18) Unsaturated trialkyl glycerides; (C16-C18) and (C18) Unsaturated trialkylglyceride; (C16-C18) and C18 unsaturated trialkyl glyceride; SDA 11-001-00; 4-(hexadecanoyloxy)-2-hydroxybutyl (3E,7E)-octadeca-3,7-dienoate |
InChI | InChI=1/C38H70O5/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-38(41)43-35-36(39)33-34-42-37(40)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h20,22,28,30,36,39H,3-19,21,23-27,29,31-35H2,1-2H3/b22-20+,30-28+ |
Molecular Formula | C38H70O5 |
Molecular Weight | 606.9594 |
Density | 0.936g/cm3 |
Boiling point | 662.7°C at 760 mmHg |
Flash point | 185.5°C |
Refractive index | 1.477 |
67701-30-8 glycerides, c16-18 and c18-unsatd.
service@apichina.com