| Product Name | Glycerides, C14-18 and C16-18-unsatd. |
| CAS No. | 67701-29-5 |
| Synonyms | (C14-C18) and (C16-C18) Unsaturated trialkyl glyceride; (C14-C18) and (C16-C18)-Unsaturated trialkyl glyceride; (C14-C18) and (C16-C18)Unsaturated trialkyl glyceride; SDA 04-001-00; SDA 04-004-00; 3,4-dihydroxy-4-[(3E,6E)-tetradeca-3,6-dienoyloxy]butanoic acid |
| InChI | InChI=1/C18H30O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(22)24-18(23)15(19)14-16(20)21/h8-9,11-12,15,18-19,23H,2-7,10,13-14H2,1H3,(H,20,21)/b9-8+,12-11+ |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.4272 |
| Density | 1.116g/cm3 |
| Boiling point | 528.8°C at 760 mmHg |
| Flash point | 182.6°C |
| Refractive index | 1.51 |
67701-29-5 glycerides, c14-18 and c16-18-unsatd.
service@apichina.com