| Product Name | Glutaranilic Acid |
| CAS No. | 5414-99-3 |
| Synonyms | N-Phenylglutaramic Acid; Pentanedioic acid mono(N-phenyl)amide; 5-oxo-5-(phenylamino)pentanoic acid; 5-oxo-5-(phenylamino)pentanoate |
| InChI | InChI=1/C11H13NO3/c13-10(7-4-8-11(14)15)12-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,12,13)(H,14,15)/p-1 |
| Molecular Formula | C11H12NO3 |
| Molecular Weight | 206.2184 |
| Boiling point | 478.5°C at 760 mmHg |
| Flash point | 243.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5414-99-3 glutaranilic acid
service@apichina.com