| Product Name | Gluconic acid |
| CAS No. | 526-95-4 |
| Synonyms | D-Gluconic acid solution; Gluconicacidaqsoln; D-Gluconic acid; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (non-preferred name); Gluconic Acid Solution |
| InChI | InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3-,4+,5-/m1/s1 |
| Molecular Formula | C6H11O7 |
| Molecular Weight | 195.1479 |
| Melting point | 15℃ |
| Boiling point | 673.6°C at 760 mmHg |
| Flash point | 375.1°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
526-95-4 gluconic acid
service@apichina.com