Product Name | Gluconic acid, sodium salt |
CAS No. | 527-07-1 |
Synonyms | SODIUM GLUCONATE RE; Gluconic Acid Sodium; Sodium gluconate; sodium 2,3,4,5,6-pentahydroxyhexanoate (non-preferred name); D-Gluconic acid, monosodium salt; Gluconic acid sodium salt |
InChI | InChI=1/C14H14O3.C6H12O7.Na/c1-8(2)7-11(15)12-13(16)9-5-3-4-6-10(9)14(12)17;7-1-2(8)3(9)4(10)5(11)6(12)13;/h3-6,8,12H,7H2,1-2H3;2-5,7-11H,1H2,(H,12,13);/q;;+1/p-1/t;2-,3-,4+,5-;/m.1./s1 |
Molecular Formula | C6H11NaO7 |
Molecular Weight | 448.3963 |
Melting point | 206-209℃ |
Safety | S24/25:Avoid contact with skin and eyes.; |
527-07-1 gluconic acid, sodium salt
service@apichina.com