| Product Name | Geranyl Bromide |
| CAS No. | 6138-90-5 |
| Synonyms | 3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
| InChI | InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| Molecular Formula | C10H17Br |
| Molecular Weight | 217.146 |
| Density | 1.121g/cm3 |
| Boiling point | 227.7°C at 760 mmHg |
| Flash point | 95°C |
| Refractive index | 1.489 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6138-90-5 geranyl bromide
service@apichina.com