| Product Name | furo[3,4-b]quinolin-1(3H)-one |
| CAS No. | 4945-38-4 |
| InChI | InChI=1/C11H7NO2/c13-11-8-5-7-3-1-2-4-9(7)12-10(8)6-14-11/h1-5H,6H2 |
| Molecular Formula | C11H7NO2 |
| Molecular Weight | 185.1788 |
| Density | 1.388g/cm3 |
| Boiling point | 437.2°C at 760 mmHg |
| Flash point | 218.2°C |
| Refractive index | 1.698 |
4945-38-4 furo[3,4-b]quinolin-1(3h)-one
service@apichina.com