| Product Name | formic acid, compound with N,N-dimethylformamide (1:1) |
| CAS No. | 68258-70-8 |
| Synonyms | Formic acid, compd. with N,N-dimethylformamide (1:1); Formic acid, N,N-dimethylformamide salt; Formic acid, compound with N,N-dimethylformamide (1:1); formic acid - N,N-dimethylformamide (1:1) |
| InChI | InChI=1/C3H7NO.CH2O2/c1-4(2)3-5;2-1-3/h3H,1-2H3;1H,(H,2,3) |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.1192 |
| Boiling point | 153°C at 760 mmHg |
| Flash point | 57.8°C |
68258-70-8 formic acid, compound with n,n-dimethylformamide (1:1)
service@apichina.com