| Product Name | formic acid, compound with 1,4-diazabicyclo[2.2.2]octane |
| CAS No. | 68227-30-5 |
| Synonyms | Formic acid, compd. with 1,4-diazabicyclo(2.2.2)octane (1:?); Formic acid, compd. with 1,4-diazabicyclo(2.2.2)octane; Formic acid, compound with 1,4-diazabicyclo(2.2.2)octane; formic acid - 1,4-diazabicyclo[2.2.2]octane (1:1) |
| InChI | InChI=1/C6H12N2.CH2O2/c1-2-8-5-3-7(1)4-6-8;2-1-3/h1-6H2;1H,(H,2,3) |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.1983 |
| Boiling point | 174°C at 760 mmHg |
| Flash point | 62.2°C |
68227-30-5 formic acid, compound with 1,4-diazabicyclo[2.2.2]octane
service@apichina.com