| Product Name | Formaldehyde, oligomeric reaction products with acetone and diphenylamine |
| CAS No. | 9003-80-9 |
| Synonyms | Formaldehyde, polymer with N-phenylbenzenamine and 2-propanone; 2-Propanone, polymer with formaldehyde and N-phenylbenzenamine; acetone, formaldehyde, N-phenylaniline |
| InChI | InChI=1/C12H11N.C3H6O.CH2O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4;1-2/h1-10,13H;1-2H3;1H2 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.3276 |
| Boiling point | 302°C at 760 mmHg |
| Flash point | 152.8°C |
9003-80-9 formaldehyde, oligomeric reaction products with acetone and diphenylamine
service@apichina.com