| Product Name | Fluorescein diacetate |
| CAS No. | 596-09-8 |
| Synonyms | Diacetylfluorescein; Fluorescein Diacetat; 3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl diacetate |
| InChI | InChI=1/C24H16O7/c1-13(25)28-15-7-9-19-21(11-15)30-22-12-16(29-14(2)26)8-10-20(22)24(19)18-6-4-3-5-17(18)23(27)31-24/h3-12H,1-2H3 |
| Molecular Formula | C24H16O7 |
| Molecular Weight | 416.3796 |
| Density | 1.47g/cm3 |
| Melting point | 206-208℃ |
| Boiling point | 604.7°C at 760 mmHg |
| Flash point | 264°C |
| Refractive index | 1.681 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
596-09-8 fluorescein diacetate
service@apichina.com
- Next:596-15-6 morphine acetate
- Previous:596-01-0 alpha-naphtholphthalein