| Product Name | Fenipentol |
| CAS No. | 583-03-9 |
| Synonyms | .alpha.-Butylbenzenemethanol; .alpha.-Butylbenzyl alcohol; 1-Phenylpentan-1-ol; 583-03-9; a-Butylbenzyl Alcohol; Benzenemethanol, .alpha.-butyl-; benzenemethanol, alpha-butyl-; Benzyl alcohol, .alpha.-butyl-; Butyl hydroxy toluene |
| InChI | InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.2441 |
| Density | 0.965g/cm3 |
| Boiling point | 245.2°C at 760 mmHg |
| Flash point | 110.7°C |
| Refractive index | 1.514 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
583-03-9 fenipentol
service@apichina.com