| Product Name | Fast Garnet GBC salt |
| CAS No. | 101-89-3 |
| Synonyms | Fast Garnet GBC sulfate salt; 2-Methyl-4-(o-tolylazo)benzenediazonium hydrogen sulphate; Fast Garnet GBC Salt; Benzenediazonium, 2-methyl-4-((2-methylphenyl)azo)-, sulfate (1:1); Benzenediazonium,2-methyl-4-[(2-methylphenyl) azo]-,sulfate (1:1); |
| InChI | InChI=1/C14H13N4.H2O4S/c1-10-5-3-4-6-14(10)18-17-12-7-8-13(16-15)11(2)9-12;1-5(2,3)4/h3-9H,1-2H3;(H2,1,2,3,4)/q+1;/p-1/b18-17+; |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.3504 |
| Hazard Symbols | |
| Risk Codes | R33:Danger of cummulative effects.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
101-89-3 fast garnet gbc salt
service@apichina.com