| Product Name | Fast Blue B zinc salt |
| CAS No. | 14263-94-6 |
| InChI | InChI=1/C14H12N4O2.4ClH.Zn/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2;;;;;/h3-8H,1-2H3;4*1H;/q+2;;;;;+2/p-4 |
| Molecular Formula | C14H12Cl4N4O2Zn |
| Molecular Weight | 475.4917 |
| Melting point | 300℃ |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R40:Possible risks of irreversible effects.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
14263-94-6 fast blue b zinc salt
service@apichina.com