| Product Name | exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride |
| CAS No. | 6118-51-0 |
| Synonyms | 5,6-Dehydronorcantharidin; exo-7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic anhydride; (3aR,4S,7R,7aS)-3a,4,7,7a-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione |
| InChI | InChI=1/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.1308 |
| Density | 1.54g/cm3 |
| Melting point | 118℃ |
| Boiling point | 372°C at 760 mmHg |
| Flash point | 172.3°C |
| Refractive index | 1.583 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6118-51-0 exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
service@apichina.com