Product Name | exo-2-Bromonorbornane |
CAS No. | 2534-77-2 |
Synonyms | exo-2-Bromobicyclo[2.2.1]heptane; 2-bromobicyclo[2.2.1]heptane; (2S)-2-bromobicyclo[2.2.1]heptane; (1S,2S,4R)-2-bromobicyclo[2.2.1]heptane |
InChI | InChI=1/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 |
Molecular Formula | C7H11Br |
Molecular Weight | 175.0662 |
Density | 1.464g/cm3 |
Boiling point | 183.8°C at 760 mmHg |
Flash point | 60°C |
Refractive index | 1.55 |
Hazard Symbols | |
Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
Safety | S24/25:Avoid contact with skin and eyes.; |
2534-77-2 exo-2-bromonorbornane
service@apichina.com