| Product Name | Ethylindole-3-acrylate,(Indole-3-acrylicacidethyl ester) |
| CAS No. | 15181-86-9 |
| Synonyms | Ethyl indole-3-acrylate, (Indole-3-acrylic acid ethyl ester); Ethyl indole-3-acrylate; Indole-3-acrylic acid ethyl ester; ethyl (2E)-3-(1H-indol-3-yl)prop-2-enoate |
| InChI | InChI=1/C13H13NO2/c1-2-16-13(15)8-7-10-9-14-12-6-4-3-5-11(10)12/h3-9,14H,2H2,1H3/b8-7+ |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.2478 |
| Density | 1.2g/cm3 |
| Boiling point | 396.4°C at 760 mmHg |
| Flash point | 193.6°C |
| Refractive index | 1.65 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
15181-86-9 ethylindole-3-acrylate,(indole-3-acrylicacidethyl ester)
service@apichina.com