| Product Name | Ethylenediaminetetraacetic acid, trisodiumsalt hydrate |
| CAS No. | 85715-60-2 |
| Synonyms | EDTA, trisodium salt hydrate; Ethylenediaminetetraacetic acid, trisodium salt hydrate |
| InChI | InChI=1/C10H16N2O8.3Na.H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;1H2/q;3*+1;/p-4 |
| Molecular Formula | C10H14N2Na3O9 |
| Molecular Weight | 375.196 |
| Melting point | 300℃ |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
85715-60-2 ethylenediaminetetraacetic acid, trisodiumsalt hydrate
service@apichina.com