| Product Name | Ethylene/vinyl acetate copolymer |
| CAS No. | 24937-78-8 |
| Synonyms | Poly(ethylene-co-vinyl acetate); Acetic Acid Ethenyl Ester, Polymer with Ethene; Ethylene-vinyl acetate copolymer; Ethylene/vinyl acetate copolymer, 14% vinyl acetate; Ethylene-vinyl acetate copolymer resin; Ethylene-vinyl acetate latex; Ethylene-vinyl acetate molding resin; eva; Ethylene Vinyl Acetate; but-3-enoic acid-ethene (1:1); VAE; VAP |
| InChI | InChI=1/C4H6O2.C2H4/c1-2-3-4(5)6;1-2/h2H,1,3H2,(H,5,6);1-2H2 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.1424 |
| Melting point | 99℃ |
| Boiling point | 170.6°C at 760 mmHg |
| Flash point | 68.2°C |
| Safety | S24/25:Avoid contact with skin and eyes.; |
24937-78-8 ethylene/vinyl acetate copolymer
service@apichina.com