| Product Name | ethylchlorofluoroacetate |
| CAS No. | 401-56-9 |
| Synonyms | Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
| InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| Molecular Formula | C4H6ClFO2 |
| Molecular Weight | 140.5406 |
| Density | 1.219g/cm3 |
| Boiling point | 129°C at 760 mmHg |
| Flash point | 44.3°C |
| Refractive index | 1.39 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
401-56-9 ethylchlorofluoroacetate
service@apichina.com