| Product Name | ethyl trans-4-bromocinnamate |
| CAS No. | 24393-53-1 |
| Synonyms | 2-Propenoic acid, 3-(4-bromophenyl)-, ethyl ester; NSC 636702; ethyl 3-(4-bromophenyl)prop-2-enoate; ethyl (2E)-3-(4-bromophenyl)prop-2-enoate |
| InChI | InChI=1/C11H11BrO2/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3-8H,2H2,1H3/b8-5+ |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.1078 |
| Density | 1.393g/cm3 |
| Boiling point | 308.6°C at 760 mmHg |
| Flash point | 150.8°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
24393-53-1 ethyl trans-4-bromocinnamate
service@apichina.com