| Product Name | Ethyl trans-3-(1-pyrrolidino)acrylate |
| CAS No. | 65651-80-1;53927-12-1 |
| Synonyms | Ethyl trans-3-(1-pyrrolidino)propenoate; Ethyl3-(1-pyrrolidinyl)acrylate; ethyl (2E)-3-(pyrrolidin-1-yl)prop-2-enoate |
| InChI | InChI=1/C9H15NO2/c1-2-12-9(11)5-8-10-6-3-4-7-10/h5,8H,2-4,6-7H2,1H3/b8-5+ |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.2209 |
| Density | 1.112g/cm3 |
| Boiling point | 245.9°C at 760 mmHg |
| Flash point | 95.9°C |
| Refractive index | 1.554 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
65651-80-1;53927-12-1 ethyl trans-3-(1-pyrrolidino)acrylate
service@apichina.com