| Product Name | ethyl trans-2-hexenoate |
| CAS No. | 27829-72-7 |
| Synonyms | trans-2-Hexenoic acid ethyl ester; ethyl (2E)-hex-2-enoate; Ethyl (E)-Hex-2-Enoate |
| InChI | InChI=1/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.1956 |
| Density | 0.901g/cm3 |
| Boiling point | 172.6°C at 760 mmHg |
| Flash point | 62.3°C |
| Refractive index | 1.432 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
27829-72-7 ethyl trans-2-hexenoate
service@apichina.com