| Product Name | Ethyl Red |
| CAS No. | 76058-33-8 |
| Synonyms | 2-[4-(Diethylamino)phenylazo]benzoic acid; 2-(4-Diethylaminophenylazo)benzoic acid; Diethyl red; 2-{(E)-[4-(diethylamino)phenyl]diazenyl}benzoate |
| InChI | InChI=1/C17H19N3O2/c1-3-20(4-2)14-11-9-13(10-12-14)18-19-16-8-6-5-7-15(16)17(21)22/h5-12H,3-4H2,1-2H3,(H,21,22)/p-1/b19-18+ |
| Molecular Formula | C17H18N3O2 |
| Molecular Weight | 296.3443 |
| Melting point | 135℃ |
| Boiling point | 496.9°C at 760 mmHg |
| Flash point | 254.3°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; R32:Contact with acids liberates very toxic gas.; |
76058-33-8 ethyl red
service@apichina.com