| Product Name | ethyl (R)-(-)-mandelate |
| CAS No. | 10606-72-1 |
| Synonyms | (-)-Ethyl mandelate; D-(-)-Mandelic acid ethyl ester; (R)-(-)-alpha-Hydroxyphenylacetic acid ethyl ester~(R)-(-)-Mandelic acid ethyl ester; ethyl (2R)-hydroxy(phenyl)ethanoate |
| InChI | InChI=1/C10H12O3/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3/t9-/m1/s1 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.147g/cm3 |
| Melting point | 33-34℃ |
| Boiling point | 254°C at 760 mmHg |
| Flash point | 118.1°C |
| Refractive index | 1.528 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
10606-72-1 ethyl (r)-(-)-mandelate
service@apichina.com