| Product Name | Ethyl phenylcyanoacetate |
| CAS No. | 4553-07-5 |
| Synonyms | Phenylcyanoacetic acid ethyl ester; ethyl cyano(phenyl)acetate; ethyl (2R)-cyano(phenyl)ethanoate; ethyl (2S)-cyano(phenyl)ethanoate; ethyl 2-cyano-2-phenylacetate |
| InChI | InChI=1/C11H11NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h3-7,10H,2H2,1H3/t10-/m1/s1 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.2105 |
| Density | 1.117g/cm3 |
| Boiling point | 275°C at 760 mmHg |
| Flash point | 137.5°C |
| Refractive index | 1.518 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
4553-07-5 ethyl phenylcyanoacetate
service@apichina.com