| Product Name | ethyl pentafluorobenzoate |
| CAS No. | 4522-93-4 |
| Synonyms | Pentafluorobenzoic acid ethyl ester |
| InChI | InChI=1/C9H5F5O2/c1-2-16-9(15)3-4(10)6(12)8(14)7(13)5(3)11/h2H2,1H3 |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.12 |
| Density | 1.431 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4522-93-4 ethyl pentafluorobenzoate
service@apichina.com