| Product Name | Ethyl n-propyl sulfide |
| CAS No. | 4110-50-3 |
| Synonyms | Ethyl n-propyl sulphide; 1-(ethylsulfanyl)propane; 3-(chloromethyl)-1,2,4,5-tetramethylbenzene; Ethyl propyl sulfide |
| InChI | InChI=1/C11H15Cl/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5H,6H2,1-4H3 |
| Molecular Formula | C11H15Cl |
| Molecular Weight | 182.6898 |
| Density | 1.002g/cm3 |
| Boiling point | 269.4°C at 760 mmHg |
| Flash point | 113.8°C |
| Refractive index | 1.519 |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4110-50-3 ethyl n-propyl sulfide
service@apichina.com