| Product Name | ethyl N-(2-cyano-3-ethoxyacryloyl)carbamate |
| CAS No. | 1187-34-4 |
| Synonyms | ethyl [(2E)-2-cyano-3-ethoxyprop-2-enoyl]carbamate |
| InChI | InChI=1/C9H12N2O4/c1-3-14-6-7(5-10)8(12)11-9(13)15-4-2/h6H,3-4H2,1-2H3,(H,11,12,13)/b7-6+ |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.2026 |
| Density | 1.181g/cm3 |
| Melting point | 116℃ |
| Refractive index | 1.476 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
1187-34-4 ethyl n-(2-cyano-3-ethoxyacryloyl)carbamate
service@apichina.com