| Product Name | ethyl isocyanatoacetate |
| CAS No. | 2949-22-6 |
| Synonyms | Ethyl N-(oxomethylene)glycinate; Glycine, N-carbonyl-, ethyl ester; ethyl N-(oxomethylidene)glycinate |
| InChI | InChI=1/C5H7NO2/c1-3-8-5(7)4-6-2/h3-4H2,1H3 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.1146 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2949-22-6 ethyl isocyanatoacetate
service@apichina.com