| Product Name | Ethyl hydrogen glutarate |
| CAS No. | 1070-62-8 |
| Synonyms | Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate |
| InChI | InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.1678 |
| Density | 1.126g/cm3 |
| Boiling point | 280°C at 760 mmHg |
| Flash point | 112.5°C |
| Refractive index | 1.444 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1070-62-8 ethyl hydrogen glutarate
service@apichina.com