| Product Name | Ethyl ethynyl carbinol |
| CAS No. | 4187-86-4 |
| Synonyms | 1-Pentyn-3-ol, (Ethyl ethynyl carbinol); 1-Pentyn-3-ol; pent-1-yn-3-ol; (3R)-pent-1-yn-3-ol; (3S)-pent-1-yn-3-ol |
| InChI | InChI=1/C5H8O/c1-3-5(6)4-2/h1,5-6H,4H2,2H3/t5-/m1/s1 |
| Molecular Formula | C5H8O |
| Molecular Weight | 84.1164 |
| Density | 0.907g/cm3 |
| Boiling point | 126.9°C at 760 mmHg |
| Flash point | 29.4°C |
| Refractive index | 1.442 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
4187-86-4 ethyl ethynyl carbinol
service@apichina.com