| Product Name | Ethyl Eosin (potassium salt) |
| CAS No. | 6359-05-3 |
| Synonyms | Eosin alcohol soluble; C.I. 45386; Solvent Red 45; ethyl 2-(2,4,5,7-tetrabromo-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoate |
| InChI | InChI=1/C22H12Br4O5/c1-2-30-22(29)10-6-4-3-5-9(10)15-11-7-13(23)18(27)16(25)20(11)31-21-12(15)8-14(24)19(28)17(21)26/h3-8,27H,2H2,1H3 |
| Molecular Formula | C22H12Br4O5 |
| Molecular Weight | 675.9437 |
| Density | 2.18g/cm3 |
| Boiling point | 661.5°C at 760 mmHg |
| Flash point | 353.8°C |
| Refractive index | 1.77 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6359-05-3 ethyl eosin (potassium salt)
service@apichina.com