| Product Name | ethyl dihydrogen phosphate, compound with triethylamine |
| CAS No. | 68318-37-6 |
| Synonyms | Phosphoric acid, monoethyl ester, compd. with N,N-diethylethanamine (1:?); Ethyl dihydrogen phosphate, compound with triethylamine; Phosphoric acid, monoethyl ester, compd. with N,N-diethylethanamine; ethyl dihydrogen phosphate - N,N-diethylethanamine (1:1) |
| InChI | InChI=1/C6H15N.C2H7O4P/c1-4-7(5-2)6-3;1-2-6-7(3,4)5/h4-6H2,1-3H3;2H2,1H3,(H2,3,4,5) |
| Molecular Formula | C8H22NO4P |
| Molecular Weight | 227.2383 |
| Boiling point | 90.5°C at 760 mmHg |
| Flash point | 151.3°C |
68318-37-6 ethyl dihydrogen phosphate, compound with triethylamine
service@apichina.com