| Product Name | ethyl dihydrogen phosphate, compound with N,N-dimethyldodecylamine (1:1) |
| CAS No. | 67846-09-7 |
| Synonyms | Phosphoric acid, monoethyl ester, compd. with N,N-dimethyl-1-dodecanamine (1:1); Ethyl dihydrogen phosphate, compound with N,N-dimethyldodecylamine(1:1); ethyl dihydrogen phosphate - N,N-dimethyldodecan-1-amine (1:1) |
| InChI | InChI=1/C14H31N.C2H7O4P/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;1-2-6-7(3,4)5/h4-14H2,1-3H3;2H2,1H3,(H2,3,4,5) |
| Molecular Formula | C16H38NO4P |
| Molecular Weight | 339.451 |
| Boiling point | 265.2°C at 760 mmHg |
| Flash point | 106.9°C |
67846-09-7 ethyl dihydrogen phosphate, compound with n,n-dimethyldodecylamine (1:1)
service@apichina.com