| Product Name | Ethyl dichlorophosphite |
| CAS No. | 1498-42-6 |
| Synonyms | Ethyl phosphorodichloridite; ethyl phosphorodichloridoite |
| InChI | InChI=1/C2H5Cl2OP/c1-2-5-6(3)4/h2H2,1H3 |
| Molecular Formula | C2H5Cl2OP |
| Molecular Weight | 146.9403 |
| Boiling point | 116.4°C at 760 mmHg |
| Flash point | 24.2°C |
| Hazard Symbols |  F:Highly flammable;  C:Corrosive; |
| Risk Codes | R11:Highly flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
1498-42-6 ethyl dichlorophosphite
service@apichina.com