| Product Name | ethyl 6-isocyanatohexanoate |
| CAS No. | 5100-36-7 |
| Synonyms | Ethyl 6-isocyanatocaproate~6-Isocyanatohexanoic acid ethyl ester |
| InChI | InChI=1/C9H15NO3/c1-2-13-9(12)6-4-3-5-7-10-8-11/h2-7H2,1H3 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.2203 |
| Density | 1.01g/cm3 |
| Boiling point | 242.3°C at 760 mmHg |
| Flash point | 91.3°C |
| Refractive index | 1.46 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5100-36-7 ethyl 6-isocyanatohexanoate
service@apichina.com