| Product Name | Ethyl 5-nitrobenzofuran-2-carboxylate |
| CAS No. | 69604-00-8 |
| Synonyms | 5-Nitrobenzo[b]furan-2-carboxylic acid ethyl ester; 5-nitro-benzofuran-2-carboxylic acid ethyl ester; Vilazodone Intermediate 7; Ethyl 5-nitrobenzo[b]furan-2-carboxylate |
| InChI | InChI=1/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.1929 |
| Density | 1.362g/cm3 |
| Melting point | 150℃ |
| Boiling point | 359.7°C at 760 mmHg |
| Flash point | 171.3°C |
| Refractive index | 1.603 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
69604-00-8 ethyl 5-nitrobenzofuran-2-carboxylate
service@apichina.com