| Product Name | Ethyl 5-methylindole-2-carboxylate |
| CAS No. | 16382-15-3 |
| Synonyms | 5-Methylindole-2-carboxylic acid ethyl ester; ethyl 5-methyl-1H-indole-2-carboxylate |
| InChI | InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.2371 |
| Density | 1.177g/cm3 |
| Boiling point | 356.5°C at 760 mmHg |
| Flash point | 169.4°C |
| Refractive index | 1.609 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
16382-15-3 ethyl 5-methylindole-2-carboxylate
service@apichina.com