| Product Name | Ethyl 5-hydroxyindole-2-carboxylate |
| CAS No. | 24985-85-1 |
| Synonyms | 5-Hydroxyindole-2-carboxylic acid ethyl ester; ethyl 5-hydroxy-1H-indole-2-carboxylate; (1-benzylpiperidin-3-yl)methanol |
| InChI | InChI=1/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,15H,4,7-11H2 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.2961 |
| Density | 1.056g/cm3 |
| Boiling point | 294.068°C at 760 mmHg |
| Flash point | 123.378°C |
| Refractive index | 1.551 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
24985-85-1 ethyl 5-hydroxyindole-2-carboxylate
service@apichina.com