| Product Name | ethyl 5-cyano-6-imino-4-methyl-1-(4-methylphenyl)-1,6-dihydropyridazine-3-carboxylate |
| CAS No. | 120049-79-8 |
| Synonyms | Ethyl 5-cyano-6-imino-4-methyl-1-(4-methylphenyl)-1,6-dihydropyridazine-3-carboxylat |
| InChI | InChI=1/C16H16N4O2/c1-4-22-16(21)14-11(3)13(9-17)15(18)20(19-14)12-7-5-10(2)6-8-12/h5-8,18H,4H2,1-3H3 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.3238 |
| Density | 1.21g/cm3 |
| Melting point | 150℃ |
| Boiling point | 415.2°C at 760 mmHg |
| Flash point | 204.9°C |
| Refractive index | 1.603 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
120049-79-8 ethyl 5-cyano-6-imino-4-methyl-1-(4-methylphenyl)-1,6-dihydropyridazine-3-carboxylate
service@apichina.com