| Product Name | ethyl 5-cyano-3,4-dimethylthieno[2,3-b]thiophene-2-carboxylate |
| CAS No. | 175202-57-0 |
| InChI | InChI=1/C12H11NO2S2/c1-4-15-11(14)10-7(3)9-6(2)8(5-13)16-12(9)17-10/h4H2,1-3H3 |
| Molecular Formula | C12H11NO2S2 |
| Molecular Weight | 265.3512 |
| Density | 1.33g/cm3 |
| Melting point | 155℃ |
| Boiling point | 421.9°C at 760 mmHg |
| Flash point | 209°C |
| Refractive index | 1.625 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175202-57-0 ethyl 5-cyano-3,4-dimethylthieno[2,3-b]thiophene-2-carboxylate
service@apichina.com