| Product Name | Ethyl 5-chlorothiophene-2-carboxylate |
| CAS No. | 5751-82-6 |
| Synonyms | 5-Chlorothiophene-2-carboxylic acid ethyl ester; Ethyl 5-chlorothiophene-2-carboxlate; |
| InChI | InChI=1/C7H7ClO2S/c1-2-10-7(9)5-3-4-6(8)11-5/h3-4H,2H2,1H3 |
| Molecular Formula | C7H7ClO2S |
| Molecular Weight | 190.6473 |
| Density | 1.312g/cm3 |
| Boiling point | 253.7°C at 760 mmHg |
| Flash point | 107.3°C |
| Refractive index | 1.545 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5751-82-6 ethyl 5-chlorothiophene-2-carboxylate
service@apichina.com