| Product Name | Ethyl 4-nitrophenylglyoxylate |
| CAS No. | 70091-75-7 |
| Synonyms | Ethyl 4-nitrobenzoylformate~4-Nitrophenylglyoxylic acid ethyl ester; ethyl (4-nitrophenyl)(oxo)acetate |
| InChI | InChI=1/C10H9NO5/c1-2-16-10(13)9(12)7-3-5-8(6-4-7)11(14)15/h3-6H,2H2,1H3 |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.1822 |
| Density | 1.318g/cm3 |
| Boiling point | 364.2°C at 760 mmHg |
| Flash point | 171°C |
| Refractive index | 1.549 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
70091-75-7 ethyl 4-nitrophenylglyoxylate
service@apichina.com