| Product Name | Ethyl 4-isocyanatobenzoate |
| CAS No. | 30806-83-8 |
| Synonyms | 4-(Ethoxycarbonyl)phenyl isocyanate; 4-Carboethoxyphenyl isocyanate; 4-Isocyanatobenzoic acid ethyl ester |
| InChI | InChI=1/C10H9NO3/c1-2-14-10(13)8-3-5-9(6-4-8)11-7-12/h3-6H,2H2,1H3 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.1834 |
| Density | 1.12g/cm3 |
| Melting point | 27-29℃ |
| Boiling point | 313.2°C at 760 mmHg |
| Flash point | 126.7°C |
| Refractive index | 1.524 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
30806-83-8 ethyl 4-isocyanatobenzoate
service@apichina.com