| Product Name | ethyl 4-(hydroxymethyl)-1,3,5-trimethyl-1H-pyrrole-2-carboxylate |
| CAS No. | 368869-99-2 |
| Synonyms | ethyl 4-(hydroxymethyl)-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| InChI | InChI=1/C10H15NO3/c1-4-14-10(13)9-6(2)8(5-12)7(3)11-9/h11-12H,4-5H2,1-3H3 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.231 |
| Density | 1.17g/cm3 |
| Melting point | 231℃ |
| Boiling point | 360.6°C at 760 mmHg |
| Flash point | 171.9°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
368869-99-2 ethyl 4-(hydroxymethyl)-1,3,5-trimethyl-1h-pyrrole-2-carboxylate
service@apichina.com