| Product Name | Ethyl 4-hydroxymandelate |
| CAS No. | 68758-68-9 |
| Synonyms | 4-Hydroxymandelic acid ethyl ester; ethyl hydroxy(4-hydroxyphenyl)acetate |
| InChI | InChI=1/C10H12O4/c1-2-14-10(13)9(12)7-3-5-8(11)6-4-7/h3-6,9,11-12H,2H2,1H3 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.1999 |
| Density | 1.262g/cm3 |
| Boiling point | 346.9°C at 760 mmHg |
| Flash point | 137.5°C |
| Refractive index | 1.56 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
68758-68-9 ethyl 4-hydroxymandelate
service@apichina.com