| Product Name | Ethyl 4-hydroxy-3-nitrobenzoate |
| CAS No. | 19013-10-6 |
| Synonyms | 4-Hydroxy-3-nitrobenzoic acid ethyl ester |
| InChI | InChI=1/C9H9NO5/c1-2-15-9(12)6-3-4-8(11)7(5-6)10(13)14/h3-5,11H,2H2,1H3 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.1715 |
| Density | 1.37g/cm3 |
| Boiling point | 323.5°C at 760 mmHg |
| Flash point | 149.5°C |
| Refractive index | 1.577 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
19013-10-6 ethyl 4-hydroxy-3-nitrobenzoate
service@apichina.com